C28H28Cl6N2O6PS+ — CID 173447602
[[acetyloxy-[(6R,7R)-2-benzhydryloxycarbonyl-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]amino]-bis(2,2,2-trichloroethyl)phosphanium (PubChem CID 173447602) has the molecular formula C28H28Cl6N2O6PS+ and a molecular weight of 764.30 g/mol. Its IUPAC name is [[acetyloxy-[(6R,7R)-2-benzhydryloxycarbonyl-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]amino]-bis(2,2,2-trichloroethyl)phosphanium.
| Compound Name | [[acetyloxy-[(6R,7R)-2-benzhydryloxycarbonyl-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]amino]-bis(2,2,2-trichloroethyl)phosphanium |
|---|---|
| PubChem CID | 173447602 |
| Molecular Formula | C28H28Cl6N2O6PS+ |
| Molecular Weight | 764.30 g/mol |
| Exact Mass | 760.95 |
| IUPAC Name | [[acetyloxy-[(6R,7R)-2-benzhydryloxycarbonyl-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]amino]-bis(2,2,2-trichloroethyl)phosphanium |
| SMILES | CO[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(C(N[PH+](CC(Cl)(Cl)Cl)CC(Cl)(Cl)Cl)OC(C)=O)CS[C@H]12 |
| InChI | InChI=1S/C28H27Cl6N2O6PS/c1-16(37)41-23(35-43(14-27(29,30)31)15-28(32,33)34)19-13-44-25-22(40-2)24(38)36(25)20(19)26(39)42-21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,21-23,25,35H,13-15H2,1-2H3/p+1/t22-,23?,25-/m1/s1 |
| InChIKey | YSXNJCWSOUFEMT-VJBIEYCASA-O |
| XLogP | 6.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.30 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|