C15H17Cl6N2O6PS — CID 88799134
(6R,7S)-3-[acetyloxy-[bis(2,2,2-trichloroethyl)phosphanylamino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88799134) has the molecular formula C15H17Cl6N2O6PS and a molecular weight of 597.07 g/mol. Its IUPAC name is (6R,7S)-3-[acetyloxy-[bis(2,2,2-trichloroethyl)phosphanylamino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-[acetyloxy-[bis(2,2,2-trichloroethyl)phosphanylamino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88799134 |
| Molecular Formula | C15H17Cl6N2O6PS |
| Molecular Weight | 597.07 g/mol |
| Exact Mass | 593.87 |
| IUPAC Name | (6R,7S)-3-[acetyloxy-[bis(2,2,2-trichloroethyl)phosphanylamino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@H]1C(=O)N2C(C(=O)O)=C(C(NP(CC(Cl)(Cl)Cl)CC(Cl)(Cl)Cl)OC(C)=O)CS[C@H]12 |
| InChI | InChI=1S/C15H17Cl6N2O6PS/c1-6(24)29-10(22-30(4-14(16,17)18)5-15(19,20)21)7-3-31-12-9(28-2)11(25)23(12)8(7)13(26)27/h9-10,12,22H,3-5H2,1-2H3,(H,26,27)/t9-,10?,12+/m0/s1 |
| InChIKey | MPYXSKWQYAENIG-VXFCFVAISA-N |
| XLogP | 3.87 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.07 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|