C20H18N2O7S — CID 54474407
(6R)-3-[acetyloxy-[(4-oxo-4-phenylbut-2-enoyl)amino]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54474407) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is (6R)-3-[acetyloxy-[(4-oxo-4-phenylbut-2-enoyl)amino]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-[acetyloxy-[(4-oxo-4-phenylbut-2-enoyl)amino]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54474407 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (6R)-3-[acetyloxy-[(4-oxo-4-phenylbut-2-enoyl)amino]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OC(NC(=O)C=CC(=O)c1ccccc1)C1=C(C(=O)O)N2C(=O)C[C@H]2SC1 |
| InChI | InChI=1S/C20H18N2O7S/c1-11(23)29-19(13-10-30-17-9-16(26)22(17)18(13)20(27)28)21-15(25)8-7-14(24)12-5-3-2-4-6-12/h2-8,17,19H,9-10H2,1H3,(H,21,25)(H,27,28)/t17-,19?/m1/s1 |
| InChIKey | XKNLOOLKLBEVLK-DUSLRRAJSA-N |
| XLogP | 1.07 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|