C18H19N3O9S — CID 88807181
(6R,7R)-3-[acetyloxy-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88807181) has the molecular formula C18H19N3O9S and a molecular weight of 453.43 g/mol. Its IUPAC name is (6R,7R)-3-[acetyloxy-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-[acetyloxy-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88807181 |
| Molecular Formula | C18H19N3O9S |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (6R,7R)-3-[acetyloxy-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC(OC(C)=O)C1=C(C(=O)O)N2C(=O)[C@@H](OC)[C@H]2SC1)c1ccco1 |
| InChI | InChI=1S/C18H19N3O9S/c1-8(22)30-15(19-14(23)11(20-28-3)10-5-4-6-29-10)9-7-31-17-13(27-2)16(24)21(17)12(9)18(25)26/h4-6,13,15,17H,7H2,1-3H3,(H,19,23)(H,25,26)/t13-,15?,17-/m1/s1 |
| InChIKey | BJECUKHYHVVMRA-GWHNWCKOSA-N |
| XLogP | -0.10 |
| TPSA | 156.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|