C10H19IO2 — CID 88795158
(E,3S)-3-(1-ethoxyethoxy)-1-iodo-4-methylpent-1-ene (PubChem CID 88795158) has the molecular formula C10H19IO2 and a molecular weight of 298.16 g/mol. Its IUPAC name is (E,3S)-3-(1-ethoxyethoxy)-1-iodo-4-methylpent-1-ene.
| Compound Name | (E,3S)-3-(1-ethoxyethoxy)-1-iodo-4-methylpent-1-ene |
|---|---|
| PubChem CID | 88795158 |
| Molecular Formula | C10H19IO2 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (E,3S)-3-(1-ethoxyethoxy)-1-iodo-4-methylpent-1-ene |
| SMILES | CCOC(C)O[C@H](/C=C/I)C(C)C |
| InChI | InChI=1S/C10H19IO2/c1-5-12-9(4)13-10(6-7-11)8(2)3/h6-10H,5H2,1-4H3/b7-6+/t9?,10-/m1/s1 |
| InChIKey | HYZFKIDHRAXRQY-NBASYVHMSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|