C8H8Cl2N2OS — CID 88795205
1-(2,3-dichlorophenyl)-3-methyl-1-sulfanylurea (PubChem CID 88795205) has the molecular formula C8H8Cl2N2OS and a molecular weight of 251.14 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-methyl-1-sulfanylurea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-methyl-1-sulfanylurea |
|---|---|
| PubChem CID | 88795205 |
| Molecular Formula | C8H8Cl2N2OS |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-methyl-1-sulfanylurea |
| SMILES | CNC(=O)N(S)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl2N2OS/c1-11-8(13)12(14)6-4-2-3-5(9)7(6)10/h2-4,14H,1H3,(H,11,13) |
| InChIKey | SRVJCGKTUHPSGP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|