2-but-2-ynylguanidine;sulfuric acid

C5H11N3O4S — CID 88797227

IUPAC2-but-2-ynylguanidine;sulfuric acid
SMILESCC#CCN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C5H9N3.H2O4S/c1-2-3-4-8-5(6)7;1-5(2,3)4/h4H2,1H3,(H4,6,7,8);(H2,1,2,3,4)
InChIKeyJVBYQWRSUUAOML-UHFFFAOYSA-N
MW209.23 g/mol
LogP-1.37
Rot. Bonds1

About 2-but-2-ynylguanidine;sulfuric acid

2-but-2-ynylguanidine;sulfuric acid (PubChem CID 88797227) has the molecular formula C5H11N3O4S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-but-2-ynylguanidine;sulfuric acid.

Molecular Properties

Compound Name2-but-2-ynylguanidine;sulfuric acid
PubChem CID88797227
Molecular FormulaC5H11N3O4S
Molecular Weight209.23 g/mol
Exact Mass209.05
IUPAC Name2-but-2-ynylguanidine;sulfuric acid
SMILESCC#CCN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C5H9N3.H2O4S/c1-2-3-4-8-5(6)7;1-5(2,3)4/h4H2,1H3,(H4,6,7,8);(H2,1,2,3,4)
InChIKeyJVBYQWRSUUAOML-UHFFFAOYSA-N
XLogP-1.37
TPSA139.00 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.23
LogP ≤ 5-1.37
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-but-2-ynylguanidine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-but-2-ynylguanidine;sulfuric acid?
The IUPAC name of 2-but-2-ynylguanidine;sulfuric acid (CID 88797227) is 2-but-2-ynylguanidine;sulfuric acid.
What is the SMILES notation for 2-but-2-ynylguanidine;sulfuric acid?
The canonical SMILES for 2-but-2-ynylguanidine;sulfuric acid is CC#CCN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of 2-but-2-ynylguanidine;sulfuric acid?
The InChIKey is JVBYQWRSUUAOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3.H2O4S/c1-2-3-4-8-5(6)7;1-5(2,3)4/h4H2,1H3,(H4,6,7,8);(H2,1,2,3,4).
What are the key properties of 2-but-2-ynylguanidine;sulfuric acid?
2-but-2-ynylguanidine;sulfuric acid has a molecular weight of 209.23 g/mol, XLogP of -1.37, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-ynylguanidine;sulfuric acid is sourced from PubChem (CID 88797227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).