C9H6O3 — CID 88800472
3H-furo[2,3-f][1,2]benzodioxole (PubChem CID 88800472) has the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. Its IUPAC name is 3H-furo[2,3-f][1,2]benzodioxole.
| Compound Name | 3H-furo[2,3-f][1,2]benzodioxole |
|---|---|
| PubChem CID | 88800472 |
| Molecular Formula | C9H6O3 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 3H-furo[2,3-f][1,2]benzodioxole |
| SMILES | c1cc2cc3c(cc2o1)COO3 |
| InChI | InChI=1S/C9H6O3/c1-2-10-8-4-7-5-11-12-9(7)3-6(1)8/h1-4H,5H2 |
| InChIKey | LWXDFXZBZMLOEV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|