About (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride
(4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride (PubChem CID 88802616) has the molecular formula C22H25Cl2N2O5P
and a molecular weight of 499.33 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride |
| PubChem CID | 88802616 |
| Molecular Formula | C22H25Cl2N2O5P |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\CNCP(=O)(Oc1ccccc1)Oc1ccccc1)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23N2O5P.2ClH/c1-26-18-12-14-19(15-13-18)27-22(23)16-24-17-30(25,28-20-8-4-2-5-9-20)29-21-10-6-3-7-11-21;;/h2-15,23-24H,16-17H2,1H3;2*1H/b23-22+;; |
| InChIKey | OVUFCBKFWNPRDE-VPMNAVQSSA-N |
| XLogP | 5.79 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride?
The IUPAC name of (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride (CID 88802616) is (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride.
What is the SMILES notation for (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride?
The canonical SMILES for (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride is Cl.Cl.[H]/N=C(\CNCP(=O)(Oc1ccccc1)Oc1ccccc1)Oc1ccc(OC)cc1.
What is the InChIKey of (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride?
The InChIKey is OVUFCBKFWNPRDE-VPMNAVQSSA-N. The full InChI is InChI=1S/C22H23N2O5P.2ClH/c1-26-18-12-14-19(15-13-18)27-22(23)16-24-17-30(25,28-20-8-4-2-5-9-20)29-21-10-6-3-7-11-21;;/h2-15,23-24H,16-17H2,1H3;2*1H/b23-22+;;.
What are the key properties of (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride?
(4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride has a molecular weight of 499.33 g/mol, XLogP of 5.79, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 2-(diphenoxyphosphorylmethylamino)ethanimidate;dihydrochloride is sourced from PubChem (CID 88802616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).