C20H21F3N2O3 — CID 8880338
(2R)-2-(2,3-dimethylphenoxy)-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]propanehydrazide (PubChem CID 8880338) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethylphenoxy)-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]propanehydrazide.
| Compound Name | (2R)-2-(2,3-dimethylphenoxy)-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]propanehydrazide |
|---|---|
| PubChem CID | 8880338 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (2R)-2-(2,3-dimethylphenoxy)-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]propanehydrazide |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)Cc2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C20H21F3N2O3/c1-12-6-4-9-17(13(12)2)28-14(3)19(27)25-24-18(26)11-15-7-5-8-16(10-15)20(21,22)23/h4-10,14H,11H2,1-3H3,(H,24,26)(H,25,27)/t14-/m1/s1 |
| InChIKey | TWCRQIZVXMBKQL-CQSZACIVSA-N |
| XLogP | 3.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|