C25H19P — CID 88803414
(2,3,4-triphenylphenyl)methylidenephosphane (PubChem CID 88803414) has the molecular formula C25H19P and a molecular weight of 350.40 g/mol. Its IUPAC name is (2,3,4-triphenylphenyl)methylidenephosphane.
| Compound Name | (2,3,4-triphenylphenyl)methylidenephosphane |
|---|---|
| PubChem CID | 88803414 |
| Molecular Formula | C25H19P |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (2,3,4-triphenylphenyl)methylidenephosphane |
| SMILES | [H]/P=C/c1ccc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H19P/c26-18-22-16-17-23(19-10-4-1-5-11-19)25(21-14-8-3-9-15-21)24(22)20-12-6-2-7-13-20/h1-18,26H |
| InChIKey | CIOMIKYKVCQRFJ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|