C18H24IN5O5S2 — CID 88803461
N-(3,4-dimethoxyphenyl)-N-methylsulfanyl-4-(5-methylsulfanyl-1,3,4-oxadiazole-2-carbonyl)piperazine-1-carboxamide;hydroiodide (PubChem CID 88803461) has the molecular formula C18H24IN5O5S2 and a molecular weight of 581.46 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-methylsulfanyl-4-(5-methylsulfanyl-1,3,4-oxadiazole-2-carbonyl)piperazine-1-carboxamide;hydroiodide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-methylsulfanyl-4-(5-methylsulfanyl-1,3,4-oxadiazole-2-carbonyl)piperazine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 88803461 |
| Molecular Formula | C18H24IN5O5S2 |
| Molecular Weight | 581.46 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-methylsulfanyl-4-(5-methylsulfanyl-1,3,4-oxadiazole-2-carbonyl)piperazine-1-carboxamide;hydroiodide |
| SMILES | COc1ccc(N(SC)C(=O)N2CCN(C(=O)c3nnc(SC)o3)CC2)cc1OC.I |
| InChI | InChI=1S/C18H23N5O5S2.HI/c1-26-13-6-5-12(11-14(13)27-2)23(30-4)18(25)22-9-7-21(8-10-22)16(24)15-19-20-17(28-15)29-3;/h5-6,11H,7-10H2,1-4H3;1H |
| InChIKey | NHYJVULLPMQKAA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|