About N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine
N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine (PubChem CID 88805864) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine |
| PubChem CID | 88805864 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine |
| SMILES | c1ccc2c(c1)CC/C2=N/Nc1ncc[nH]1 |
| InChI | InChI=1S/C12H12N4/c1-2-4-10-9(3-1)5-6-11(10)15-16-12-13-7-8-14-12/h1-4,7-8H,5-6H2,(H2,13,14,16)/b15-11- |
| InChIKey | UOLVVEMAKJZFKE-PTNGSMBKSA-N |
| XLogP | 2.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine?
The IUPAC name of N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine (CID 88805864) is N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine.
What is the SMILES notation for N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine?
The canonical SMILES for N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine is c1ccc2c(c1)CC/C2=N/Nc1ncc[nH]1.
What is the InChIKey of N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine?
The InChIKey is UOLVVEMAKJZFKE-PTNGSMBKSA-N. The full InChI is InChI=1S/C12H12N4/c1-2-4-10-9(3-1)5-6-11(10)15-16-12-13-7-8-14-12/h1-4,7-8H,5-6H2,(H2,13,14,16)/b15-11-.
What are the key properties of N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine?
N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine has a molecular weight of 212.26 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2,3-dihydroinden-1-ylideneamino]-1H-imidazol-2-amine is sourced from PubChem (CID 88805864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).