C20H17N3O4S — CID 88808723
[3-(1,3-benzothiazol-2-yl)-1-(2-methylbut-3-yn-2-yl)-2-oxoimidazolidin-4-yl] furan-2-carboxylate (PubChem CID 88808723) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-1-(2-methylbut-3-yn-2-yl)-2-oxoimidazolidin-4-yl] furan-2-carboxylate.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-1-(2-methylbut-3-yn-2-yl)-2-oxoimidazolidin-4-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 88808723 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-1-(2-methylbut-3-yn-2-yl)-2-oxoimidazolidin-4-yl] furan-2-carboxylate |
| SMILES | C#CC(C)(C)N1CC(OC(=O)c2ccco2)N(c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C20H17N3O4S/c1-4-20(2,3)22-12-16(27-17(24)14-9-7-11-26-14)23(19(22)25)18-21-13-8-5-6-10-15(13)28-18/h1,5-11,16H,12H2,2-3H3 |
| InChIKey | DPTALSBOVBOAMH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|