C24H20N2O3S — CID 8881063
N'-benzoyl-3-(benzylsulfanylmethyl)-1-benzofuran-2-carbohydrazide (PubChem CID 8881063) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is N'-benzoyl-3-(benzylsulfanylmethyl)-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-benzoyl-3-(benzylsulfanylmethyl)-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 8881063 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N'-benzoyl-3-(benzylsulfanylmethyl)-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1oc2ccccc2c1CSCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O3S/c27-23(18-11-5-2-6-12-18)25-26-24(28)22-20(19-13-7-8-14-21(19)29-22)16-30-15-17-9-3-1-4-10-17/h1-14H,15-16H2,(H,25,27)(H,26,28) |
| InChIKey | JMJGKYISYNWSJZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|