C10H14ClNO6 — CID 88815539
[(2R,3R,5R,6R)-3-acetyloxy-6-chloro-5-nitrosooxan-2-yl]methyl acetate (PubChem CID 88815539) has the molecular formula C10H14ClNO6 and a molecular weight of 279.68 g/mol. Its IUPAC name is [(2R,3R,5R,6R)-3-acetyloxy-6-chloro-5-nitrosooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5R,6R)-3-acetyloxy-6-chloro-5-nitrosooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 88815539 |
| Molecular Formula | C10H14ClNO6 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [(2R,3R,5R,6R)-3-acetyloxy-6-chloro-5-nitrosooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Cl)[C@H](N=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H14ClNO6/c1-5(13)16-4-9-8(17-6(2)14)3-7(12-15)10(11)18-9/h7-10H,3-4H2,1-2H3/t7-,8-,9-,10+/m1/s1 |
| InChIKey | UQLYHFSMYCVJTH-KYXWUPHJSA-N |
| XLogP | 0.97 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|