About bis(carbamoylamino) propyl phosphate
bis(carbamoylamino) propyl phosphate (PubChem CID 88818411) has the molecular formula C5H13N4O6P
and a molecular weight of 256.15 g/mol. Its IUPAC name is bis(carbamoylamino) propyl phosphate.
Molecular Properties
| Compound Name | bis(carbamoylamino) propyl phosphate |
| PubChem CID | 88818411 |
| Molecular Formula | C5H13N4O6P |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | bis(carbamoylamino) propyl phosphate |
| SMILES | CCCOP(=O)(ONC(N)=O)ONC(N)=O |
| InChI | InChI=1S/C5H13N4O6P/c1-2-3-13-16(12,14-8-4(6)10)15-9-5(7)11/h2-3H2,1H3,(H3,6,8,10)(H3,7,9,11) |
| InChIKey | MOXHQRFHMMGACG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(carbamoylamino) propyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbamoylamino) propyl phosphate?
The IUPAC name of bis(carbamoylamino) propyl phosphate (CID 88818411) is bis(carbamoylamino) propyl phosphate.
What is the SMILES notation for bis(carbamoylamino) propyl phosphate?
The canonical SMILES for bis(carbamoylamino) propyl phosphate is CCCOP(=O)(ONC(N)=O)ONC(N)=O.
What is the InChIKey of bis(carbamoylamino) propyl phosphate?
The InChIKey is MOXHQRFHMMGACG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N4O6P/c1-2-3-13-16(12,14-8-4(6)10)15-9-5(7)11/h2-3H2,1H3,(H3,6,8,10)(H3,7,9,11).
What are the key properties of bis(carbamoylamino) propyl phosphate?
bis(carbamoylamino) propyl phosphate has a molecular weight of 256.15 g/mol, XLogP of -0.28, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbamoylamino) propyl phosphate is sourced from PubChem (CID 88818411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).