C20H16N4O2S — CID 8881889
N-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 8881889) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8881889 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | N#CCOc1ccc(/C=N\NC(=O)Cc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C20H16N4O2S/c21-10-11-26-17-8-6-15(7-9-17)13-22-24-19(25)12-20-23-18(14-27-20)16-4-2-1-3-5-16/h1-9,13-14H,11-12H2,(H,24,25)/b22-13- |
| InChIKey | LMKAPPZQAAGTSC-XKZIYDEJSA-N |
| XLogP | 3.41 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|