C16H16I3N3O8 — CID 88819784
(2S)-2-[[2,4,6-triiodo-3-[(2-methoxyacetyl)amino]-5-(methylcarbamoyl)benzoyl]amino]butanedioic acid (PubChem CID 88819784) has the molecular formula C16H16I3N3O8 and a molecular weight of 759.03 g/mol. Its IUPAC name is (2S)-2-[[2,4,6-triiodo-3-[(2-methoxyacetyl)amino]-5-(methylcarbamoyl)benzoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2,4,6-triiodo-3-[(2-methoxyacetyl)amino]-5-(methylcarbamoyl)benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 88819784 |
| Molecular Formula | C16H16I3N3O8 |
| Molecular Weight | 759.03 g/mol |
| Exact Mass | 758.81 |
| IUPAC Name | (2S)-2-[[2,4,6-triiodo-3-[(2-methoxyacetyl)amino]-5-(methylcarbamoyl)benzoyl]amino]butanedioic acid |
| SMILES | CNC(=O)c1c(I)c(NC(=O)COC)c(I)c(C(=O)N[C@@H](CC(=O)O)C(=O)O)c1I |
| InChI | InChI=1S/C16H16I3N3O8/c1-20-14(26)8-10(17)9(15(27)21-5(16(28)29)3-7(24)25)12(19)13(11(8)18)22-6(23)4-30-2/h5H,3-4H2,1-2H3,(H,20,26)(H,21,27)(H,22,23)(H,24,25)(H,28,29)/t5-/m0/s1 |
| InChIKey | IJVFMMRRAVKGIT-YFKPBYRVSA-N |
| XLogP | 1.10 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.03 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|