C21H20N4O6S2 — CID 88820605
(6S)-3-(benzoylsulfanylmethyl)-7-[[2-(1H-imidazol-2-yl)acetyl]amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88820605) has the molecular formula C21H20N4O6S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is (6S)-3-(benzoylsulfanylmethyl)-7-[[2-(1H-imidazol-2-yl)acetyl]amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-(benzoylsulfanylmethyl)-7-[[2-(1H-imidazol-2-yl)acetyl]amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88820605 |
| Molecular Formula | C21H20N4O6S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | (6S)-3-(benzoylsulfanylmethyl)-7-[[2-(1H-imidazol-2-yl)acetyl]amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC1(NC(=O)Cc2ncc[nH]2)C(=O)N2C(C(=O)O)=C(CSC(=O)c3ccccc3)CS[C@H]21 |
| InChI | InChI=1S/C21H20N4O6S2/c1-31-21(24-15(26)9-14-22-7-8-23-14)19(30)25-16(17(27)28)13(11-33-20(21)25)10-32-18(29)12-5-3-2-4-6-12/h2-8,20H,9-11H2,1H3,(H,22,23)(H,24,26)(H,27,28)/t20-,21?/m0/s1 |
| InChIKey | KGSNQYSKGMRYCL-BGERDNNASA-N |
| XLogP | 1.24 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|