C29H41NO6S — CID 88823704
N-[5-(4-decoxyphenyl)sulfonyl-2-hydroxyphenyl]-4,4-dimethyl-3-oxopentanamide (PubChem CID 88823704) has the molecular formula C29H41NO6S and a molecular weight of 531.72 g/mol. Its IUPAC name is N-[5-(4-decoxyphenyl)sulfonyl-2-hydroxyphenyl]-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[5-(4-decoxyphenyl)sulfonyl-2-hydroxyphenyl]-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 88823704 |
| Molecular Formula | C29H41NO6S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | N-[5-(4-decoxyphenyl)sulfonyl-2-hydroxyphenyl]-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCCCCCCCCCOc1ccc(S(=O)(=O)c2ccc(O)c(NC(=O)CC(=O)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C29H41NO6S/c1-5-6-7-8-9-10-11-12-19-36-22-13-15-23(16-14-22)37(34,35)24-17-18-26(31)25(20-24)30-28(33)21-27(32)29(2,3)4/h13-18,20,31H,5-12,19,21H2,1-4H3,(H,30,33) |
| InChIKey | HBPNENCWRJADLY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|