C9H7ClN2O — CID 88825083
4-chloro-N'-hydroxybicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide (PubChem CID 88825083) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 4-chloro-N'-hydroxybicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide.
| Compound Name | 4-chloro-N'-hydroxybicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide |
|---|---|
| PubChem CID | 88825083 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 4-chloro-N'-hydroxybicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide |
| SMILES | NC(=NO)C1=Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H7ClN2O/c10-6-2-1-5-3-8(7(5)4-6)9(11)12-13/h1-4,13H,(H2,11,12) |
| InChIKey | XOXPGVHNFZGKAT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|