C16H15ClN2O — CID 88825651
N'-phenylmethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride (PubChem CID 88825651) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is N'-phenylmethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride.
| Compound Name | N'-phenylmethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 88825651 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N'-phenylmethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride |
| SMILES | Cl.NC(=NOCc1ccccc1)C1=Cc2ccccc21 |
| InChI | InChI=1S/C16H14N2O.ClH/c17-16(15-10-13-8-4-5-9-14(13)15)18-19-11-12-6-2-1-3-7-12;/h1-10H,11H2,(H2,17,18);1H |
| InChIKey | UURFKNLQMIXFFG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|