About bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide
bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide (PubChem CID 45084239) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide.
Analyze bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide?
The IUPAC name of bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide (CID 45084239) is bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide.
What is the SMILES notation for bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide?
The canonical SMILES for bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide is NC(=O)C1=Cc2ccccc21.
What is the InChIKey of bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide?
The InChIKey is IXWZTBUVAOCXGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c10-9(11)8-5-6-3-1-2-4-7(6)8/h1-5H,(H2,10,11).
What are the key properties of bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide?
bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide has a molecular weight of 145.16 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboxamide is sourced from PubChem (CID 45084239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).