C12H9NO3 — CID 67866188
(Z)-4-amino-2-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)-4-oxobut-2-enoic acid (PubChem CID 67866188) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is (Z)-4-amino-2-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-amino-2-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 67866188 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (Z)-4-amino-2-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)-4-oxobut-2-enoic acid |
| SMILES | NC(=O)/C=C(\C(=O)O)C1=Cc2ccccc21 |
| InChI | InChI=1S/C12H9NO3/c13-11(14)6-10(12(15)16)9-5-7-3-1-2-4-8(7)9/h1-6H,(H2,13,14)(H,15,16)/b10-6- |
| InChIKey | QWVDOOFNEDJIKP-POHAHGRESA-N |
| XLogP | 1.04 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|