C32H35N3O5 — CID 88826102
bis(1,2,3,4-tetrahydronaphthalen-1-ylamino) (2R)-2-benzamidopentanedioate (PubChem CID 88826102) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is bis(1,2,3,4-tetrahydronaphthalen-1-ylamino) (2R)-2-benzamidopentanedioate.
| Compound Name | bis(1,2,3,4-tetrahydronaphthalen-1-ylamino) (2R)-2-benzamidopentanedioate |
|---|---|
| PubChem CID | 88826102 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | bis(1,2,3,4-tetrahydronaphthalen-1-ylamino) (2R)-2-benzamidopentanedioate |
| SMILES | O=C(CC[C@@H](NC(=O)c1ccccc1)C(=O)ONC1CCCc2ccccc21)ONC1CCCc2ccccc21 |
| InChI | InChI=1S/C32H35N3O5/c36-30(39-34-27-18-8-14-22-10-4-6-16-25(22)27)21-20-29(33-31(37)24-12-2-1-3-13-24)32(38)40-35-28-19-9-15-23-11-5-7-17-26(23)28/h1-7,10-13,16-17,27-29,34-35H,8-9,14-15,18-21H2,(H,33,37)/t27?,28?,29-/m1/s1 |
| InChIKey | GLIHJTPFWDVLEE-BVDFDZHASA-N |
| XLogP | 4.82 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|