C25H31NO5 — CID 88826866
1-[benzyl(propan-2-yl)amino]-3-[[2-(2-ethenylperoxyethyl)-1-benzofuran-7-yl]oxy]propan-2-ol (PubChem CID 88826866) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[benzyl(propan-2-yl)amino]-3-[[2-(2-ethenylperoxyethyl)-1-benzofuran-7-yl]oxy]propan-2-ol.
| Compound Name | 1-[benzyl(propan-2-yl)amino]-3-[[2-(2-ethenylperoxyethyl)-1-benzofuran-7-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 88826866 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-[benzyl(propan-2-yl)amino]-3-[[2-(2-ethenylperoxyethyl)-1-benzofuran-7-yl]oxy]propan-2-ol |
| SMILES | C=COOCCc1cc2cccc(OCC(O)CN(Cc3ccccc3)C(C)C)c2o1 |
| InChI | InChI=1S/C25H31NO5/c1-4-29-30-14-13-23-15-21-11-8-12-24(25(21)31-23)28-18-22(27)17-26(19(2)3)16-20-9-6-5-7-10-20/h4-12,15,19,22,27H,1,13-14,16-18H2,2-3H3 |
| InChIKey | RSEVLJJHXNMSQV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|