About 3-hydroxyprop-2-ynyl 3-oxobutanoate
3-hydroxyprop-2-ynyl 3-oxobutanoate (PubChem CID 88827468) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-hydroxyprop-2-ynyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 3-hydroxyprop-2-ynyl 3-oxobutanoate |
| PubChem CID | 88827468 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3-hydroxyprop-2-ynyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC#CO |
| InChI | InChI=1S/C7H8O4/c1-6(9)5-7(10)11-4-2-3-8/h8H,4-5H2,1H3 |
| InChIKey | QNBNNRWKLUENHU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyprop-2-ynyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyprop-2-ynyl 3-oxobutanoate?
The IUPAC name of 3-hydroxyprop-2-ynyl 3-oxobutanoate (CID 88827468) is 3-hydroxyprop-2-ynyl 3-oxobutanoate.
What is the SMILES notation for 3-hydroxyprop-2-ynyl 3-oxobutanoate?
The canonical SMILES for 3-hydroxyprop-2-ynyl 3-oxobutanoate is CC(=O)CC(=O)OCC#CO.
What is the InChIKey of 3-hydroxyprop-2-ynyl 3-oxobutanoate?
The InChIKey is QNBNNRWKLUENHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-6(9)5-7(10)11-4-2-3-8/h8H,4-5H2,1H3.
What are the key properties of 3-hydroxyprop-2-ynyl 3-oxobutanoate?
3-hydroxyprop-2-ynyl 3-oxobutanoate has a molecular weight of 156.14 g/mol, XLogP of -0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyprop-2-ynyl 3-oxobutanoate is sourced from PubChem (CID 88827468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).