C18H32O2 — CID 88827532
3-[(5E,7E)-9-ethoxy-3,7-dimethylnona-5,7-dienyl]-2-ethyl-2-methyloxirane (PubChem CID 88827532) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 3-[(5E,7E)-9-ethoxy-3,7-dimethylnona-5,7-dienyl]-2-ethyl-2-methyloxirane.
| Compound Name | 3-[(5E,7E)-9-ethoxy-3,7-dimethylnona-5,7-dienyl]-2-ethyl-2-methyloxirane |
|---|---|
| PubChem CID | 88827532 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 3-[(5E,7E)-9-ethoxy-3,7-dimethylnona-5,7-dienyl]-2-ethyl-2-methyloxirane |
| SMILES | CCOC/C=C(C)/C=C/CC(C)CCC1OC1(C)CC |
| InChI | InChI=1S/C18H32O2/c1-6-18(5)17(20-18)12-11-15(3)9-8-10-16(4)13-14-19-7-2/h8,10,13,15,17H,6-7,9,11-12,14H2,1-5H3/b10-8+,16-13+ |
| InChIKey | DVBWNEHYEKQEME-ZQHUEGGHSA-N |
| XLogP | 4.90 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|