About azanide;iridium;2-methylbutanoyloxyazanide
azanide;iridium;2-methylbutanoyloxyazanide (PubChem CID 88828500) has the molecular formula C5H12IrN2O2-2
and a molecular weight of 324.38 g/mol. Its IUPAC name is azanide;iridium;2-methylbutanoyloxyazanide.
Molecular Properties
| Compound Name | azanide;iridium;2-methylbutanoyloxyazanide |
| PubChem CID | 88828500 |
| Molecular Formula | C5H12IrN2O2-2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | azanide;iridium;2-methylbutanoyloxyazanide |
| SMILES | CCC(C)C(=O)O[NH-].[Ir].[NH2-] |
| InChI | InChI=1S/C5H10NO2.Ir.H2N/c1-3-4(2)5(7)8-6;;/h4,6H,3H2,1-2H3;;1H2/q-1;;-1 |
| InChIKey | RZFHEBMBJIBJTK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanide;iridium;2-methylbutanoyloxyazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;iridium;2-methylbutanoyloxyazanide?
The IUPAC name of azanide;iridium;2-methylbutanoyloxyazanide (CID 88828500) is azanide;iridium;2-methylbutanoyloxyazanide.
What is the SMILES notation for azanide;iridium;2-methylbutanoyloxyazanide?
The canonical SMILES for azanide;iridium;2-methylbutanoyloxyazanide is CCC(C)C(=O)O[NH-].[Ir].[NH2-].
What is the InChIKey of azanide;iridium;2-methylbutanoyloxyazanide?
The InChIKey is RZFHEBMBJIBJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO2.Ir.H2N/c1-3-4(2)5(7)8-6;;/h4,6H,3H2,1-2H3;;1H2/q-1;;-1.
What are the key properties of azanide;iridium;2-methylbutanoyloxyazanide?
azanide;iridium;2-methylbutanoyloxyazanide has a molecular weight of 324.38 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;iridium;2-methylbutanoyloxyazanide is sourced from PubChem (CID 88828500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).