About CID 173066748
CID 173066748 (PubChem CID 173066748) has the molecular formula C5H9O3Sn
and a molecular weight of 235.83 g/mol.
Molecular Properties
| Compound Name | CID 173066748 |
| PubChem CID | 173066748 |
| Molecular Formula | C5H9O3Sn |
| Molecular Weight | 235.83 g/mol |
| Exact Mass | 236.96 |
| IUPAC Name | — |
| SMILES | CCC(C)C(=O)O[Sn]=O |
| InChI | InChI=1S/C5H10O2.O.Sn/c1-3-4(2)5(6)7;;/h4H,3H2,1-2H3,(H,6,7);;/q;;+1/p-1 |
| InChIKey | ZBUAMAIYXMMJRS-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.83 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 173066748 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173066748?
The IUPAC name of CID 173066748 (CID 173066748) is not available.
What is the SMILES notation for CID 173066748?
The canonical SMILES for CID 173066748 is CCC(C)C(=O)O[Sn]=O.
What is the InChIKey of CID 173066748?
The InChIKey is ZBUAMAIYXMMJRS-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O2.O.Sn/c1-3-4(2)5(6)7;;/h4H,3H2,1-2H3,(H,6,7);;/q;;+1/p-1.
What are the key properties of CID 173066748?
CID 173066748 has a molecular weight of 235.83 g/mol, XLogP of 0.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173066748 is sourced from PubChem (CID 173066748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).