C8H17NO5S — CID 88830332
3-[methyl(2-methylpropyl)amino]-2-sulfopropanoic acid (PubChem CID 88830332) has the molecular formula C8H17NO5S and a molecular weight of 239.29 g/mol. Its IUPAC name is 3-[methyl(2-methylpropyl)amino]-2-sulfopropanoic acid.
| Compound Name | 3-[methyl(2-methylpropyl)amino]-2-sulfopropanoic acid |
|---|---|
| PubChem CID | 88830332 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-[methyl(2-methylpropyl)amino]-2-sulfopropanoic acid |
| SMILES | CC(C)CN(C)CC(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C8H17NO5S/c1-6(2)4-9(3)5-7(8(10)11)15(12,13)14/h6-7H,4-5H2,1-3H3,(H,10,11)(H,12,13,14) |
| InChIKey | CDGWVLBAUVQXCY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|