C16H17NO2S2 — CID 88835199
(2S)-2-amino-3-[2-[bis(prop-2-ynylsulfanyl)methyl]phenyl]propanoic acid (PubChem CID 88835199) has the molecular formula C16H17NO2S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-[bis(prop-2-ynylsulfanyl)methyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-[bis(prop-2-ynylsulfanyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 88835199 |
| Molecular Formula | C16H17NO2S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | (2S)-2-amino-3-[2-[bis(prop-2-ynylsulfanyl)methyl]phenyl]propanoic acid |
| SMILES | C#CCSC(SCC#C)c1ccccc1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H17NO2S2/c1-3-9-20-16(21-10-4-2)13-8-6-5-7-12(13)11-14(17)15(18)19/h1-2,5-8,14,16H,9-11,17H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | WODCSALPTRLLNG-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|