C8H15FO6 — CID 88836641
2,2-bis(hydroxymethyl)propane-1,3-diol;2-fluoroprop-2-enoic acid (PubChem CID 88836641) has the molecular formula C8H15FO6 and a molecular weight of 226.20 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2-fluoroprop-2-enoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 88836641 |
| Molecular Formula | C8H15FO6 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-fluoroprop-2-enoic acid |
| SMILES | C=C(F)C(=O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C3H3FO2/c6-1-5(2-7,3-8)4-9;1-2(4)3(5)6/h6-9H,1-4H2;1H2,(H,5,6) |
| InChIKey | WGPOTBBVVMEIOX-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|