C18H33NO2 — CID 88844095
(4E)-3-[2-(diethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid (PubChem CID 88844095) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is (4E)-3-[2-(diethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid.
| Compound Name | (4E)-3-[2-(diethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid |
|---|---|
| PubChem CID | 88844095 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | (4E)-3-[2-(diethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid |
| SMILES | CCN(CC)CCC(/C=C(\C)CCC=C(C)C)CC(=O)O |
| InChI | InChI=1S/C18H33NO2/c1-6-19(7-2)12-11-17(14-18(20)21)13-16(5)10-8-9-15(3)4/h9,13,17H,6-8,10-12,14H2,1-5H3,(H,20,21)/b16-13+ |
| InChIKey | PSNVMVIYRQGIAF-DTQAZKPQSA-N |
| XLogP | 4.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|