C18H16Br4O8 — CID 88845335
(Z)-4-oxo-4-[2-(2,3,4,5-tetrabromo-6-butoxycarbonylbenzoyl)oxyethoxy]but-2-enoic acid (PubChem CID 88845335) has the molecular formula C18H16Br4O8 and a molecular weight of 679.93 g/mol. Its IUPAC name is (Z)-4-oxo-4-[2-(2,3,4,5-tetrabromo-6-butoxycarbonylbenzoyl)oxyethoxy]but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[2-(2,3,4,5-tetrabromo-6-butoxycarbonylbenzoyl)oxyethoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 88845335 |
| Molecular Formula | C18H16Br4O8 |
| Molecular Weight | 679.93 g/mol |
| Exact Mass | 675.76 |
| IUPAC Name | (Z)-4-oxo-4-[2-(2,3,4,5-tetrabromo-6-butoxycarbonylbenzoyl)oxyethoxy]but-2-enoic acid |
| SMILES | CCCCOC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCCOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H16Br4O8/c1-2-3-6-29-17(26)11-12(14(20)16(22)15(21)13(11)19)18(27)30-8-7-28-10(25)5-4-9(23)24/h4-5H,2-3,6-8H2,1H3,(H,23,24)/b5-4- |
| InChIKey | JIPFUFLILVRVJH-PLNGDYQASA-N |
| XLogP | 5.03 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|