C16H24O2 — CID 88847490
(2-hydroperoxy-1-methyl-4-propan-2-ylcyclohexyl)benzene (PubChem CID 88847490) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2-hydroperoxy-1-methyl-4-propan-2-ylcyclohexyl)benzene.
| Compound Name | (2-hydroperoxy-1-methyl-4-propan-2-ylcyclohexyl)benzene |
|---|---|
| PubChem CID | 88847490 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2-hydroperoxy-1-methyl-4-propan-2-ylcyclohexyl)benzene |
| SMILES | CC(C)C1CCC(C)(c2ccccc2)C(OO)C1 |
| InChI | InChI=1S/C16H24O2/c1-12(2)13-9-10-16(3,15(11-13)18-17)14-7-5-4-6-8-14/h4-8,12-13,15,17H,9-11H2,1-3H3 |
| InChIKey | MLJNRHHDJKRKDQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|