C6H8N2O3S2 — CID 88848079
(6S)-7-amino-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]octane-2-carboxylic acid (PubChem CID 88848079) has the molecular formula C6H8N2O3S2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (6S)-7-amino-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]octane-2-carboxylic acid.
| Compound Name | (6S)-7-amino-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 88848079 |
| Molecular Formula | C6H8N2O3S2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | (6S)-7-amino-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
| SMILES | NC1C(=O)N2C(C(=O)O)CSS[C@@H]12 |
| InChI | InChI=1S/C6H8N2O3S2/c7-3-4(9)8-2(6(10)11)1-12-13-5(3)8/h2-3,5H,1,7H2,(H,10,11)/t2?,3?,5-/m0/s1 |
| InChIKey | SLQFEHFFHQRIIK-VCVVDONISA-N |
| XLogP | -0.67 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|