C7H8N2O4S — CID 102211620
(2S,5R,6R)-6-formamido-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 102211620) has the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. Its IUPAC name is (2S,5R,6R)-6-formamido-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-formamido-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 102211620 |
| Molecular Formula | C7H8N2O4S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | (2S,5R,6R)-6-formamido-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | O=CN[C@@H]1C(=O)N2[C@@H](C(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C7H8N2O4S/c10-2-8-4-5(11)9-3(7(12)13)1-14-6(4)9/h2-4,6H,1H2,(H,8,10)(H,12,13)/t3-,4-,6-/m1/s1 |
| InChIKey | SEUWTRODJOKSPE-ZMIZWQJLSA-N |
| XLogP | -1.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|