C18H34O4 — CID 88848715
2-(7-ethylperoxy-2,4,7,9-tetramethyldec-5-yn-4-yl)oxyethanol (PubChem CID 88848715) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(7-ethylperoxy-2,4,7,9-tetramethyldec-5-yn-4-yl)oxyethanol.
| Compound Name | 2-(7-ethylperoxy-2,4,7,9-tetramethyldec-5-yn-4-yl)oxyethanol |
|---|---|
| PubChem CID | 88848715 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2-(7-ethylperoxy-2,4,7,9-tetramethyldec-5-yn-4-yl)oxyethanol |
| SMILES | CCOOC(C)(C#CC(C)(CC(C)C)OCCO)CC(C)C |
| InChI | InChI=1S/C18H34O4/c1-8-21-22-18(7,14-16(4)5)10-9-17(6,13-15(2)3)20-12-11-19/h15-16,19H,8,11-14H2,1-7H3 |
| InChIKey | GNQQWDFSHHTXFB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|