C23H44O6S — CID 58719233
4-[2-[7-(3-hydroxypropyl)-2,4,7,9-tetramethyldec-5-yn-4-yl]oxyethoxy]butane-1-sulfonic acid (PubChem CID 58719233) has the molecular formula C23H44O6S and a molecular weight of 448.67 g/mol. Its IUPAC name is 4-[2-[7-(3-hydroxypropyl)-2,4,7,9-tetramethyldec-5-yn-4-yl]oxyethoxy]butane-1-sulfonic acid.
| Compound Name | 4-[2-[7-(3-hydroxypropyl)-2,4,7,9-tetramethyldec-5-yn-4-yl]oxyethoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58719233 |
| Molecular Formula | C23H44O6S |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 4-[2-[7-(3-hydroxypropyl)-2,4,7,9-tetramethyldec-5-yn-4-yl]oxyethoxy]butane-1-sulfonic acid |
| SMILES | CC(C)CC(C)(C#CC(C)(CC(C)C)OCCOCCCCS(=O)(=O)O)CCCO |
| InChI | InChI=1S/C23H44O6S/c1-20(2)18-22(5,10-9-13-24)11-12-23(6,19-21(3)4)29-16-15-28-14-7-8-17-30(25,26)27/h20-21,24H,7-10,13-19H2,1-6H3,(H,25,26,27) |
| InChIKey | JFACZGKJJZQKFE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|