C44H82O9 — CID 161270672
2-(3,5-dimethylhex-1-yn-3-yloxy)ethanol;5-(2-hydroxyethoxy)-2,5-dimethylhex-3-yn-2-ol;2-[9-(2-hydroxyethoxy)-2,4,6,9,11,13-hexamethyltetradec-7-yn-6-yl]oxyethanol (PubChem CID 161270672) has the molecular formula C44H82O9 and a molecular weight of 755.13 g/mol. Its IUPAC name is 2-(3,5-dimethylhex-1-yn-3-yloxy)ethanol;5-(2-hydroxyethoxy)-2,5-dimethylhex-3-yn-2-ol;2-[9-(2-hydroxyethoxy)-2,4,6,9,11,13-hexamethyltetradec-7-yn-6-yl]oxyethanol.
| Compound Name | 2-(3,5-dimethylhex-1-yn-3-yloxy)ethanol;5-(2-hydroxyethoxy)-2,5-dimethylhex-3-yn-2-ol;2-[9-(2-hydroxyethoxy)-2,4,6,9,11,13-hexamethyltetradec-7-yn-6-yl]oxyethanol |
|---|---|
| PubChem CID | 161270672 |
| Molecular Formula | C44H82O9 |
| Molecular Weight | 755.13 g/mol |
| Exact Mass | 754.60 |
| IUPAC Name | 2-(3,5-dimethylhex-1-yn-3-yloxy)ethanol;5-(2-hydroxyethoxy)-2,5-dimethylhex-3-yn-2-ol;2-[9-(2-hydroxyethoxy)-2,4,6,9,11,13-hexamethyltetradec-7-yn-6-yl]oxyethanol |
| SMILES | C#CC(C)(CC(C)C)OCCO.CC(C)(O)C#CC(C)(C)OCCO.CC(C)CC(C)CC(C)(C#CC(C)(CC(C)CC(C)C)OCCO)OCCO |
| InChI | InChI=1S/C24H46O4.C10H18O3.C10H18O2/c1-19(2)15-21(5)17-23(7,27-13-11-25)9-10-24(8,28-14-12-26)18-22(6)16-20(3)4;1-9(2,12)5-6-10(3,4)13-8-7-11;1-5-10(4,8-9(2)3)12-7-6-11/h19-22,25-26H,11-18H2,1-8H3;11-12H,7-8H2,1-4H3;1,9,11H,6-8H2,2-4H3 |
| InChIKey | VDTRFPWBCXSUNR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.13 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|