C16H28O3 — CID 88790706
ethynol;2,4,7,9-tetramethyldec-5-yne-4,7-diol (PubChem CID 88790706) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is ethynol;2,4,7,9-tetramethyldec-5-yne-4,7-diol.
| Compound Name | ethynol;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
|---|---|
| PubChem CID | 88790706 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | ethynol;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
| SMILES | C#CO.CC(C)CC(C)(O)C#CC(C)(O)CC(C)C |
| InChI | InChI=1S/C14H26O2.C2H2O/c1-11(2)9-13(5,15)7-8-14(6,16)10-12(3)4;1-2-3/h11-12,15-16H,9-10H2,1-6H3;1,3H |
| InChIKey | IWSRYRXARYGUSH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|