C12H26O2 — CID 89484377
3-tert-butyl-3,5-dimethylhexane-2,2-diol (PubChem CID 89484377) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-tert-butyl-3,5-dimethylhexane-2,2-diol.
| Compound Name | 3-tert-butyl-3,5-dimethylhexane-2,2-diol |
|---|---|
| PubChem CID | 89484377 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 3-tert-butyl-3,5-dimethylhexane-2,2-diol |
| SMILES | CC(C)CC(C)(C(C)(C)C)C(C)(O)O |
| InChI | InChI=1S/C12H26O2/c1-9(2)8-11(6,10(3,4)5)12(7,13)14/h9,13-14H,8H2,1-7H3 |
| InChIKey | IDHZFZJPLZNSBY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|