About 3-tert-butyl-3,5-dimethylhexane-2,2-diol
3-tert-butyl-3,5-dimethylhexane-2,2-diol (PubChem CID 89484377) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-tert-butyl-3,5-dimethylhexane-2,2-diol.
Molecular Properties
| Compound Name | 3-tert-butyl-3,5-dimethylhexane-2,2-diol |
| PubChem CID | 89484377 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 3-tert-butyl-3,5-dimethylhexane-2,2-diol |
| SMILES | CC(C)CC(C)(C(C)(C)C)C(C)(O)O |
| InChI | InChI=1S/C12H26O2/c1-9(2)8-11(6,10(3,4)5)12(7,13)14/h9,13-14H,8H2,1-7H3 |
| InChIKey | IDHZFZJPLZNSBY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-3,5-dimethylhexane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-3,5-dimethylhexane-2,2-diol?
The IUPAC name of 3-tert-butyl-3,5-dimethylhexane-2,2-diol (CID 89484377) is 3-tert-butyl-3,5-dimethylhexane-2,2-diol.
What is the SMILES notation for 3-tert-butyl-3,5-dimethylhexane-2,2-diol?
The canonical SMILES for 3-tert-butyl-3,5-dimethylhexane-2,2-diol is CC(C)CC(C)(C(C)(C)C)C(C)(O)O.
What is the InChIKey of 3-tert-butyl-3,5-dimethylhexane-2,2-diol?
The InChIKey is IDHZFZJPLZNSBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2/c1-9(2)8-11(6,10(3,4)5)12(7,13)14/h9,13-14H,8H2,1-7H3.
What are the key properties of 3-tert-butyl-3,5-dimethylhexane-2,2-diol?
3-tert-butyl-3,5-dimethylhexane-2,2-diol has a molecular weight of 202.34 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-3,5-dimethylhexane-2,2-diol is sourced from PubChem (CID 89484377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).