C16H28O2 — CID 159479828
acetylene;2,4,7,9-tetramethyldec-5-yne-4,7-diol (PubChem CID 159479828) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is acetylene;2,4,7,9-tetramethyldec-5-yne-4,7-diol.
| Compound Name | acetylene;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
|---|---|
| PubChem CID | 159479828 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | acetylene;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
| SMILES | C#C.CC(C)CC(C)(O)C#CC(C)(O)CC(C)C |
| InChI | InChI=1S/C14H26O2.C2H2/c1-11(2)9-13(5,15)7-8-14(6,16)10-12(3)4;1-2/h11-12,15-16H,9-10H2,1-6H3;1-2H |
| InChIKey | LWVZLTLMVOLBQD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|