C24H42O2 — CID 87658422
2,4,7,9-tetramethylicosa-5,15-diyne-4,7-diol (PubChem CID 87658422) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 2,4,7,9-tetramethylicosa-5,15-diyne-4,7-diol.
| Compound Name | 2,4,7,9-tetramethylicosa-5,15-diyne-4,7-diol |
|---|---|
| PubChem CID | 87658422 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 2,4,7,9-tetramethylicosa-5,15-diyne-4,7-diol |
| SMILES | CCCCC#CCCCCCC(C)CC(C)(O)C#CC(C)(O)CC(C)C |
| InChI | InChI=1S/C24H42O2/c1-7-8-9-10-11-12-13-14-15-16-22(4)20-24(6,26)18-17-23(5,25)19-21(2)3/h21-22,25-26H,7-9,12-16,19-20H2,1-6H3 |
| InChIKey | IZXONEJIXHVCJQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|