C26H48O4 — CID 160526423
4,7-dimethyldec-5-yne-4,7-diol;2,4,7,9-tetramethyldec-5-yne-4,7-diol (PubChem CID 160526423) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is 4,7-dimethyldec-5-yne-4,7-diol;2,4,7,9-tetramethyldec-5-yne-4,7-diol.
| Compound Name | 4,7-dimethyldec-5-yne-4,7-diol;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
|---|---|
| PubChem CID | 160526423 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | 4,7-dimethyldec-5-yne-4,7-diol;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
| SMILES | CC(C)CC(C)(O)C#CC(C)(O)CC(C)C.CCCC(C)(O)C#CC(C)(O)CCC |
| InChI | InChI=1S/C14H26O2.C12H22O2/c1-11(2)9-13(5,15)7-8-14(6,16)10-12(3)4;1-5-7-11(3,13)9-10-12(4,14)8-6-2/h11-12,15-16H,9-10H2,1-6H3;13-14H,5-8H2,1-4H3 |
| InChIKey | QUYMBZUAFVXGFK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|