About N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine
N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine (PubChem CID 88851735) has the molecular formula C7H18Cl3N3Si
and a molecular weight of 278.69 g/mol. Its IUPAC name is N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine |
| PubChem CID | 88851735 |
| Molecular Formula | C7H18Cl3N3Si |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCNCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C7H18Cl3N3Si/c8-14(9,10)7-1-3-12-5-6-13-4-2-11/h12-13H,1-7,11H2 |
| InChIKey | XBHNDOHSLHFKKZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine?
The IUPAC name of N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine (CID 88851735) is N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine is NCCNCCNCCC[Si](Cl)(Cl)Cl.
What is the InChIKey of N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine?
The InChIKey is XBHNDOHSLHFKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18Cl3N3Si/c8-14(9,10)7-1-3-12-5-6-13-4-2-11/h12-13H,1-7,11H2.
What are the key properties of N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine?
N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine has a molecular weight of 278.69 g/mol, XLogP of 1.17, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(3-trichlorosilylpropylamino)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 88851735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).