C10H6ClN3O — CID 88854660
2-(chloromethyl)-5-(4-isocyanophenyl)-1,3,4-oxadiazole (PubChem CID 88854660) has the molecular formula C10H6ClN3O and a molecular weight of 219.63 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(4-isocyanophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(4-isocyanophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 88854660 |
| Molecular Formula | C10H6ClN3O |
| Molecular Weight | 219.63 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-(chloromethyl)-5-(4-isocyanophenyl)-1,3,4-oxadiazole |
| SMILES | [C-]#[N+]c1ccc(-c2nnc(CCl)o2)cc1 |
| InChI | InChI=1S/C10H6ClN3O/c1-12-8-4-2-7(3-5-8)10-14-13-9(6-11)15-10/h2-5H,6H2 |
| InChIKey | MKFZELGDWDENDJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|