About [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol
[(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol (PubChem CID 88863243) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol.
Molecular Properties
| Compound Name | [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol |
| PubChem CID | 88863243 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)[C@@H]2OC2(C)C)cc1 |
| InChI | InChI=1S/C12H16O2/c1-8-4-6-9(7-5-8)10(13)11-12(2,3)14-11/h4-7,10-11,13H,1-3H3/t10?,11-/m0/s1 |
| InChIKey | PUYFRWKVLYVNMK-DTIOYNMSSA-N |
| XLogP | 2.21 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol?
The IUPAC name of [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol (CID 88863243) is [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol.
What is the SMILES notation for [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol?
The canonical SMILES for [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol is Cc1ccc(C(O)[C@@H]2OC2(C)C)cc1.
What is the InChIKey of [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol?
The InChIKey is PUYFRWKVLYVNMK-DTIOYNMSSA-N. The full InChI is InChI=1S/C12H16O2/c1-8-4-6-9(7-5-8)10(13)11-12(2,3)14-11/h4-7,10-11,13H,1-3H3/t10?,11-/m0/s1.
What are the key properties of [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol?
[(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol has a molecular weight of 192.26 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3,3-dimethyloxiran-2-yl]-(4-methylphenyl)methanol is sourced from PubChem (CID 88863243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).